Customer matched zone "Locations not covered by your other zones"
View cart “Hach DPD Total Refill Vial” has been added to your cart.
Potassium Peroxy Disulfate (K2S2O8)-100g
$75.46
Description
Equivalent to VWR # AAJ66672-22
Properties
|
|
|
|
| grade |
ACS reagent |
|
puriss. p.a. |
| assay |
≥99.0% (RT) |
| form |
powder or crystals |
| impurities |
≤0.001% total nitrogen (N) |
| pH |
2.5-4.5 (25 °C, 27 g/L) |
| anion traces |
chloride (Cl–): ≤10 mg/kg |
| cation traces |
Ag: ≤5 mg/kg |
|
Al: ≤5 mg/kg |
|
Ba: ≤5 mg/kg |
|
Bi: ≤5 mg/kg |
|
Ca: ≤50 mg/kg |
|
Cd: ≤5 mg/kg |
|
Co: ≤5 mg/kg |
|
Cr: ≤5 mg/kg |
|
Cu: ≤5 mg/kg |
|
Fe: ≤5 mg/kg |
|
Li: ≤5 mg/kg |
|
Mg: ≤100 mg/kg |
|
Mn: ≤1 mg/kg |
|
Mo: ≤5 mg/kg |
|
Na: ≤200 mg/kg |
|
Ni: ≤5 mg/kg |
|
Pb: ≤5 mg/kg |
|
Sr: ≤5 mg/kg |
|
Tl: ≤5 mg/kg |
|
Zn: ≤5 mg/kg |
| Featured Industry |
Forensics and Toxicology |
| SMILES string |
[K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| InChI |
1S/2K.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChI key |
USHAGKDGDHPEEY-UHFFFAOYSA-L |